C36H48O12 — CID 73226707
[6-(furan-3-yl)-15,16-dihydroxy-12-(2-methoxy-2-oxoethyl)-7,11,13,13-tetramethyl-14-(2-methylpropanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadec-2-en-18-yl] 2-methylbutanoate (PubChem CID 73226707) has the molecular formula C36H48O12 and a molecular weight of 672.77 g/mol. Its IUPAC name is [6-(furan-3-yl)-15,16-dihydroxy-12-(2-methoxy-2-oxoethyl)-7,11,13,13-tetramethyl-14-(2-methylpropanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadec-2-en-18-yl] 2-methylbutanoate.
| Compound Name | [6-(furan-3-yl)-15,16-dihydroxy-12-(2-methoxy-2-oxoethyl)-7,11,13,13-tetramethyl-14-(2-methylpropanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadec-2-en-18-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 73226707 |
| Molecular Formula | C36H48O12 |
| Molecular Weight | 672.77 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | [6-(furan-3-yl)-15,16-dihydroxy-12-(2-methoxy-2-oxoethyl)-7,11,13,13-tetramethyl-14-(2-methylpropanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadec-2-en-18-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C23OC4(O)C(C)(C(CC(=O)OC)C(C)(C)C(OC(=O)C(C)C)C14O)C2CCC1(C)C3=CC(=O)OC1c1ccoc1 |
| InChI | InChI=1S/C36H48O12/c1-10-19(4)28(40)47-30-34-21(11-13-32(7)23(34)16-25(38)45-26(32)20-12-14-44-17-20)33(8)22(15-24(37)43-9)31(5,6)29(46-27(39)18(2)3)35(30,41)36(33,42)48-34/h12,14,16-19,21-22,26,29-30,41-42H,10-11,13,15H2,1-9H3 |
| InChIKey | GEBIODNQUHSEMX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 168.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|