C36H50O12 — CID 163107316
methyl 6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-14,18-bis(2-methylbutanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecane-12-carboxylate (PubChem CID 163107316) has the molecular formula C36H50O12 and a molecular weight of 674.78 g/mol. Its IUPAC name is methyl 6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-14,18-bis(2-methylbutanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecane-12-carboxylate.
| Compound Name | methyl 6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-14,18-bis(2-methylbutanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecane-12-carboxylate |
|---|---|
| PubChem CID | 163107316 |
| Molecular Formula | C36H50O12 |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | methyl 6-(furan-3-yl)-15,16-dihydroxy-7,11,13,13-tetramethyl-14,18-bis(2-methylbutanoyloxy)-4-oxo-5,17-dioxapentacyclo[13.2.1.01,10.02,7.011,16]octadecane-12-carboxylate |
| SMILES | CCC(C)C(=O)OC1C(C)(C)C(C(=O)OC)C2(C)C3CCC4(C)C(c5ccoc5)OC(=O)CC4C34OC2(O)C1(O)C4OC(=O)C(C)CC |
| InChI | InChI=1S/C36H50O12/c1-10-18(3)26(38)46-29-31(5,6)24(28(40)43-9)33(8)21-12-14-32(7)22(16-23(37)45-25(32)20-13-15-44-17-20)34(21)30(47-27(39)19(4)11-2)35(29,41)36(33,42)48-34/h13,15,17-19,21-22,24-25,29-30,41-42H,10-12,14,16H2,1-9H3 |
| InChIKey | AYBDREWRKZTAAJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 168.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|