C26H32O5 — CID 102117202
(1R,2R,5S,6R,10R,13R,16S)-6-(furan-3-yl)-5,10,14,14-tetramethyl-15,19-dioxapentacyclo[11.7.0.01,16.02,10.05,9]icos-8-ene-11,18-dione (PubChem CID 102117202) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is (1R,2R,5S,6R,10R,13R,16S)-6-(furan-3-yl)-5,10,14,14-tetramethyl-15,19-dioxapentacyclo[11.7.0.01,16.02,10.05,9]icos-8-ene-11,18-dione.
| Compound Name | (1R,2R,5S,6R,10R,13R,16S)-6-(furan-3-yl)-5,10,14,14-tetramethyl-15,19-dioxapentacyclo[11.7.0.01,16.02,10.05,9]icos-8-ene-11,18-dione |
|---|---|
| PubChem CID | 102117202 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (1R,2R,5S,6R,10R,13R,16S)-6-(furan-3-yl)-5,10,14,14-tetramethyl-15,19-dioxapentacyclo[11.7.0.01,16.02,10.05,9]icos-8-ene-11,18-dione |
| SMILES | CC1(C)O[C@H]2CC(=O)OC[C@@]23[C@H]1CC(=O)[C@@]1(C)C2=CC[C@@H](c4ccoc4)[C@]2(C)CC[C@@H]13 |
| InChI | InChI=1S/C26H32O5/c1-23(2)19-11-20(27)25(4)17-6-5-16(15-8-10-29-13-15)24(17,3)9-7-18(25)26(19)14-30-22(28)12-21(26)31-23/h6,8,10,13,16,18-19,21H,5,7,9,11-12,14H2,1-4H3/t16-,18-,19-,21-,24-,25-,26+/m0/s1 |
| InChIKey | OXRFOFGXNAZNSV-PJHHLLCLSA-N |
| XLogP | 4.82 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|