C30H38O8 — CID 162848880
[7-acetyloxy-17-(2-hydroxy-5-oxo-2H-furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 162848880) has the molecular formula C30H38O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is [7-acetyloxy-17-(2-hydroxy-5-oxo-2H-furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [7-acetyloxy-17-(2-hydroxy-5-oxo-2H-furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 162848880 |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [7-acetyloxy-17-(2-hydroxy-5-oxo-2H-furan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | CC(=O)OC1C2C(C)(C)C(=O)C=CC2(C)C2CCC3(C)C(=CCC3C3=CC(=O)OC3O)C2(C)C1OC(C)=O |
| InChI | InChI=1S/C30H38O8/c1-15(31)36-23-24-27(3,4)21(33)11-13-29(24,6)20-10-12-28(5)18(17-14-22(34)38-26(17)35)8-9-19(28)30(20,7)25(23)37-16(2)32/h9,11,13-14,18,20,23-26,35H,8,10,12H2,1-7H3 |
| InChIKey | FUQDGWUWPSRVAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|