C31H38O9 — CID 102286736
[(1R,4bR,5S,6R,10aR,12aR)-6-acetyloxy-1-(furan-3-yl)-1-hydroxy-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,10b,11,12-hexahydronaphtho[2,1-f]isochromen-5-yl] propanoate (PubChem CID 102286736) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is [(1R,4bR,5S,6R,10aR,12aR)-6-acetyloxy-1-(furan-3-yl)-1-hydroxy-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,10b,11,12-hexahydronaphtho[2,1-f]isochromen-5-yl] propanoate.
| Compound Name | [(1R,4bR,5S,6R,10aR,12aR)-6-acetyloxy-1-(furan-3-yl)-1-hydroxy-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,10b,11,12-hexahydronaphtho[2,1-f]isochromen-5-yl] propanoate |
|---|---|
| PubChem CID | 102286736 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [(1R,4bR,5S,6R,10aR,12aR)-6-acetyloxy-1-(furan-3-yl)-1-hydroxy-4b,7,7,10a,12a-pentamethyl-3,8-dioxo-5,6,6a,10b,11,12-hexahydronaphtho[2,1-f]isochromen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@H](OC(C)=O)C2C(C)(C)C(=O)C=C[C@]2(C)C2CC[C@]3(C)C(=CC(=O)O[C@@]3(O)c3ccoc3)[C@@]21C |
| InChI | InChI=1S/C31H38O9/c1-8-22(34)39-26-24(38-17(2)32)25-27(3,4)21(33)10-12-28(25,5)19-9-13-29(6)20(30(19,26)7)15-23(35)40-31(29,36)18-11-14-37-16-18/h10-12,14-16,19,24-26,36H,8-9,13H2,1-7H3/t19?,24-,25?,26-,28-,29-,30-,31+/m1/s1 |
| InChIKey | MUAXFLBQOUZERP-JBNUDUGESA-N |
| XLogP | 4.39 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|