C32H42O7 — CID 10840125
[(6R,7S,8R,9R,10R,13S,17R)-6-hydroxy-17-(2-methoxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate (PubChem CID 10840125) has the molecular formula C32H42O7 and a molecular weight of 538.68 g/mol. Its IUPAC name is [(6R,7S,8R,9R,10R,13S,17R)-6-hydroxy-17-(2-methoxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate.
| Compound Name | [(6R,7S,8R,9R,10R,13S,17R)-6-hydroxy-17-(2-methoxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10840125 |
| Molecular Formula | C32H42O7 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [(6R,7S,8R,9R,10R,13S,17R)-6-hydroxy-17-(2-methoxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate |
| SMILES | COC1C=C([C@@H]2CC=C3[C@]4(C)[C@H](OC(=O)C=C(C)C)[C@H](O)C5C(C)(C)C(=O)C=C[C@]5(C)[C@H]4CC[C@]32C)C(=O)O1 |
| InChI | InChI=1S/C32H42O7/c1-17(2)15-23(34)38-27-25(35)26-29(3,4)22(33)12-14-31(26,6)21-11-13-30(5)19(9-10-20(30)32(21,27)7)18-16-24(37-8)39-28(18)36/h10,12,14-16,19,21,24-27,35H,9,11,13H2,1-8H3/t19-,21+,24?,25+,26?,27+,30-,31+,32-/m0/s1 |
| InChIKey | BDOVEZSKAKIKOT-QFMMJPITSA-N |
| XLogP | 4.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|