C32H42O10 — CID 85302768
[17-(2,5-dihydroxy-2,5-dihydrofuran-3-yl)-11,12-dihydroxy-6-methoxy-4,4,8,10,13-pentamethyl-1,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate (PubChem CID 85302768) has the molecular formula C32H42O10 and a molecular weight of 586.68 g/mol. Its IUPAC name is [17-(2,5-dihydroxy-2,5-dihydrofuran-3-yl)-11,12-dihydroxy-6-methoxy-4,4,8,10,13-pentamethyl-1,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate.
| Compound Name | [17-(2,5-dihydroxy-2,5-dihydrofuran-3-yl)-11,12-dihydroxy-6-methoxy-4,4,8,10,13-pentamethyl-1,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 85302768 |
| Molecular Formula | C32H42O10 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | [17-(2,5-dihydroxy-2,5-dihydrofuran-3-yl)-11,12-dihydroxy-6-methoxy-4,4,8,10,13-pentamethyl-1,16-dioxo-6,7,9,11,12,17-hexahydro-5H-cyclopenta[a]phenanthren-7-yl] 3-methylbut-2-enoate |
| SMILES | COC1C(OC(=O)C=C(C)C)C2(C)C3=CC(=O)C(C4=CC(O)OC4O)C3(C)C(O)C(O)C2C2(C)C(=O)C=CC(C)(C)C12 |
| InChI | InChI=1S/C32H42O10/c1-14(2)11-19(35)41-27-23(40-8)25-29(3,4)10-9-18(34)32(25,7)24-22(37)26(38)30(5)17(31(24,27)6)13-16(33)21(30)15-12-20(36)42-28(15)39/h9-13,20-28,36-39H,1-8H3 |
| InChIKey | VLJSCGXPWWMGGI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|