C20H28O4 — CID 85224353
(9-hydroxy-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl) 2-methylbut-2-enoate (PubChem CID 85224353) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (9-hydroxy-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl) 2-methylbut-2-enoate.
| Compound Name | (9-hydroxy-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 85224353 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (9-hydroxy-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(C)(C)C2C(O)CC(C)C23C=CC(=O)C13C |
| InChI | InChI=1S/C20H28O4/c1-7-11(2)16(23)24-17-18(4,5)15-13(21)10-12(3)20(15)9-8-14(22)19(17,20)6/h7-9,12-13,15,17,21H,10H2,1-6H3 |
| InChIKey | GGMZSZPEXMFREO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|