C19H22O5 — CID 162820138
[(4S,4aR,5S,7R)-7-hydroxy-4a,5-dimethyl-9-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162820138) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(4S,4aR,5S,7R)-7-hydroxy-4a,5-dimethyl-9-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4S,4aR,5S,7R)-7-hydroxy-4a,5-dimethyl-9-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162820138 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(4S,4aR,5S,7R)-7-hydroxy-4a,5-dimethyl-9-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1c2ccoc2C(=O)C2=C[C@H](O)C[C@H](C)[C@]21C |
| InChI | InChI=1S/C19H22O5/c1-5-10(2)18(22)24-17-13-6-7-23-16(13)15(21)14-9-12(20)8-11(3)19(14,17)4/h5-7,9,11-12,17,20H,8H2,1-4H3/b10-5-/t11-,12+,17+,19+/m0/s1 |
| InChIKey | VWUPQZXUHCYORA-ZEQRYJAYSA-N |
| XLogP | 3.36 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|