C30H42O7 — CID 162873279
[2,6,6,9-tetramethyl-3,5-bis(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undecanyl] 2-methylbut-2-enoate (PubChem CID 162873279) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is [2,6,6,9-tetramethyl-3,5-bis(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undecanyl] 2-methylbut-2-enoate.
| Compound Name | [2,6,6,9-tetramethyl-3,5-bis(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undecanyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162873279 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | [2,6,6,9-tetramethyl-3,5-bis(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undecanyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)C(C)=CC)C(C)(C)C2C3C(=O)CC(C)C2C3(C)C1OC(=O)C(C)=CC |
| InChI | InChI=1S/C30H42O7/c1-11-15(4)26(32)35-23-24(36-27(33)16(5)12-2)29(8,9)22-20-18(7)14-19(31)21(22)30(20,10)25(23)37-28(34)17(6)13-3/h11-13,18,20-25H,14H2,1-10H3 |
| InChIKey | SSENABWRZNKLRW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|