C30H42O7 — CID 163073455
[3,7,9-trimethyl-4,6-bis(2-methylbut-2-enoyloxy)-11-oxo-3-tricyclo[5.4.0.02,8]undecanyl]methyl 2-methylbut-2-enoate (PubChem CID 163073455) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is [3,7,9-trimethyl-4,6-bis(2-methylbut-2-enoyloxy)-11-oxo-3-tricyclo[5.4.0.02,8]undecanyl]methyl 2-methylbut-2-enoate.
| Compound Name | [3,7,9-trimethyl-4,6-bis(2-methylbut-2-enoyloxy)-11-oxo-3-tricyclo[5.4.0.02,8]undecanyl]methyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163073455 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | [3,7,9-trimethyl-4,6-bis(2-methylbut-2-enoyloxy)-11-oxo-3-tricyclo[5.4.0.02,8]undecanyl]methyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC1(C)C(OC(=O)C(C)=CC)CC(OC(=O)C(C)=CC)C2(C)C3C(=O)CC(C)C2C31 |
| InChI | InChI=1S/C30H42O7/c1-10-16(4)26(32)35-15-29(8)21(36-27(33)17(5)11-2)14-22(37-28(34)18(6)12-3)30(9)23-19(7)13-20(31)24(30)25(23)29/h10-12,19,21-25H,13-15H2,1-9H3 |
| InChIKey | PDGKVVODDUICHR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|