C19H24O4 — CID 162968789
[(1R,5S,6R,7R)-10-formyl-6-methyl-2-oxo-6-tricyclo[5.3.1.01,5]undec-9-enyl]methyl (E)-2-methylbut-2-enoate (PubChem CID 162968789) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(1R,5S,6R,7R)-10-formyl-6-methyl-2-oxo-6-tricyclo[5.3.1.01,5]undec-9-enyl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,5S,6R,7R)-10-formyl-6-methyl-2-oxo-6-tricyclo[5.3.1.01,5]undec-9-enyl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162968789 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1R,5S,6R,7R)-10-formyl-6-methyl-2-oxo-6-tricyclo[5.3.1.01,5]undec-9-enyl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC[C@]1(C)[C@@H]2CC=C(C=O)[C@]3(C2)C(=O)CC[C@H]31 |
| InChI | InChI=1S/C19H24O4/c1-4-12(2)17(22)23-11-18(3)13-5-6-14(10-20)19(9-13)15(18)7-8-16(19)21/h4,6,10,13,15H,5,7-9,11H2,1-3H3/b12-4+/t13-,15+,18-,19+/m1/s1 |
| InChIKey | YUKYBBOQNUTDCI-BIAANWMDSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|