C20H26O5 — CID 100926857
[(2S,5R,7R,8S,11S)-2,10-diformyl-11-hydroxy-6,6-dimethyl-8-tricyclo[5.3.1.01,5]undec-9-enyl] (Z)-2-methylbut-2-enoate (PubChem CID 100926857) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(2S,5R,7R,8S,11S)-2,10-diformyl-11-hydroxy-6,6-dimethyl-8-tricyclo[5.3.1.01,5]undec-9-enyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2S,5R,7R,8S,11S)-2,10-diformyl-11-hydroxy-6,6-dimethyl-8-tricyclo[5.3.1.01,5]undec-9-enyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 100926857 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(2S,5R,7R,8S,11S)-2,10-diformyl-11-hydroxy-6,6-dimethyl-8-tricyclo[5.3.1.01,5]undec-9-enyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C=C(C=O)C23C(C=O)CC[C@@H]2C(C)(C)[C@@H]1[C@@H]3O |
| InChI | InChI=1S/C20H26O5/c1-5-11(2)18(24)25-14-8-13(10-22)20-12(9-21)6-7-15(20)19(3,4)16(14)17(20)23/h5,8-10,12,14-17,23H,6-7H2,1-4H3/b11-5-/t12?,14-,15+,16-,17-,20?/m0/s1 |
| InChIKey | QJAPEUZKZMNVIB-MXMFQZCGSA-N |
| XLogP | 2.23 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|