C25H34O7 — CID 10388873
[(3R,5R,8E,10R,11S,12R)-3,8,12-trimethyl-12-[(Z)-2-methylbut-2-enoyl]oxy-13-oxo-4,14-dioxatricyclo[9.3.0.03,5]tetradec-8-en-10-yl] (Z)-2-methylbut-2-enoate (PubChem CID 10388873) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [(3R,5R,8E,10R,11S,12R)-3,8,12-trimethyl-12-[(Z)-2-methylbut-2-enoyl]oxy-13-oxo-4,14-dioxatricyclo[9.3.0.03,5]tetradec-8-en-10-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3R,5R,8E,10R,11S,12R)-3,8,12-trimethyl-12-[(Z)-2-methylbut-2-enoyl]oxy-13-oxo-4,14-dioxatricyclo[9.3.0.03,5]tetradec-8-en-10-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10388873 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(3R,5R,8E,10R,11S,12R)-3,8,12-trimethyl-12-[(Z)-2-methylbut-2-enoyl]oxy-13-oxo-4,14-dioxatricyclo[9.3.0.03,5]tetradec-8-en-10-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1/C=C(\C)CC[C@H]2O[C@]2(C)CC2OC(=O)[C@](C)(OC(=O)/C(C)=C\C)[C@@H]21 |
| InChI | InChI=1S/C25H34O7/c1-8-15(4)21(26)29-17-12-14(3)10-11-19-24(6,31-19)13-18-20(17)25(7,23(28)30-18)32-22(27)16(5)9-2/h8-9,12,17-20H,10-11,13H2,1-7H3/b14-12+,15-8-,16-9-/t17-,18?,19-,20-,24-,25-/m1/s1 |
| InChIKey | LZXPHUXPDVBGGC-CHZKZAAUSA-N |
| XLogP | 3.96 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|