C25H34O8 — CID 101260397
[(1S,2S,3S,5S,8R,10S,12R,15R)-5,10,15-trimethyl-15-[(Z)-2-methylbut-2-enoyl]oxy-14-oxo-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 101260397) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is [(1S,2S,3S,5S,8R,10S,12R,15R)-5,10,15-trimethyl-15-[(Z)-2-methylbut-2-enoyl]oxy-14-oxo-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2S,3S,5S,8R,10S,12R,15R)-5,10,15-trimethyl-15-[(Z)-2-methylbut-2-enoyl]oxy-14-oxo-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101260397 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [(1S,2S,3S,5S,8R,10S,12R,15R)-5,10,15-trimethyl-15-[(Z)-2-methylbut-2-enoyl]oxy-14-oxo-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1[C@@H]2[C@@H](C[C@]3(C)O[C@@H]3CC[C@]3(C)O[C@@H]13)OC(=O)[C@]2(C)OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C25H34O8/c1-8-13(3)20(26)30-18-17-15(29-22(28)25(17,7)33-21(27)14(4)9-2)12-24(6)16(31-24)10-11-23(5)19(18)32-23/h8-9,15-19H,10-12H2,1-7H3/b13-8-,14-9-/t15-,16-,17+,18+,19+,23+,24+,25-/m1/s1 |
| InChIKey | XYXAYBUVLPKFTC-FUJYRKGDSA-N |
| XLogP | 3.17 |
| TPSA | 103.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|