C25H38O7 — CID 162905516
[(1R,4R,6S,9R,10R,11R)-9-(2-hydroxypropan-2-yl)-1-methyl-10-[(Z)-2-methylbut-2-enoyl]oxy-5,12-dioxatricyclo[9.1.0.04,6]dodecan-6-yl]methyl (Z)-2-methylbut-2-enoate (PubChem CID 162905516) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(1R,4R,6S,9R,10R,11R)-9-(2-hydroxypropan-2-yl)-1-methyl-10-[(Z)-2-methylbut-2-enoyl]oxy-5,12-dioxatricyclo[9.1.0.04,6]dodecan-6-yl]methyl (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,4R,6S,9R,10R,11R)-9-(2-hydroxypropan-2-yl)-1-methyl-10-[(Z)-2-methylbut-2-enoyl]oxy-5,12-dioxatricyclo[9.1.0.04,6]dodecan-6-yl]methyl (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162905516 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(1R,4R,6S,9R,10R,11R)-9-(2-hydroxypropan-2-yl)-1-methyl-10-[(Z)-2-methylbut-2-enoyl]oxy-5,12-dioxatricyclo[9.1.0.04,6]dodecan-6-yl]methyl (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC[C@@]12CC[C@@H](C(C)(C)O)[C@@H](OC(=O)/C(C)=C\C)[C@H]3O[C@]3(C)CC[C@H]1O2 |
| InChI | InChI=1S/C25H38O7/c1-8-15(3)21(26)29-14-25-13-10-17(23(5,6)28)19(30-22(27)16(4)9-2)20-24(7,32-20)12-11-18(25)31-25/h8-9,17-20,28H,10-14H2,1-7H3/b15-8-,16-9-/t17-,18-,19-,20-,24-,25+/m1/s1 |
| InChIKey | TUVAKELLEXKYKM-NCCUCYHHSA-N |
| XLogP | 3.63 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|