C24H36O7 — CID 44583722
[(1R,3R,5S,7S,12R,13S,16S)-12-acetyloxy-16-(2-hydroxypropan-2-yl)-13-methyl-10-methylidene-2,6-dioxatetracyclo[11.3.0.01,3.05,7]hexadecan-5-yl]methyl acetate (PubChem CID 44583722) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1R,3R,5S,7S,12R,13S,16S)-12-acetyloxy-16-(2-hydroxypropan-2-yl)-13-methyl-10-methylidene-2,6-dioxatetracyclo[11.3.0.01,3.05,7]hexadecan-5-yl]methyl acetate.
| Compound Name | [(1R,3R,5S,7S,12R,13S,16S)-12-acetyloxy-16-(2-hydroxypropan-2-yl)-13-methyl-10-methylidene-2,6-dioxatetracyclo[11.3.0.01,3.05,7]hexadecan-5-yl]methyl acetate |
|---|---|
| PubChem CID | 44583722 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1R,3R,5S,7S,12R,13S,16S)-12-acetyloxy-16-(2-hydroxypropan-2-yl)-13-methyl-10-methylidene-2,6-dioxatetracyclo[11.3.0.01,3.05,7]hexadecan-5-yl]methyl acetate |
| SMILES | C=C1CC[C@@H]2O[C@]2(COC(C)=O)C[C@H]2O[C@@]23[C@H](C(C)(C)O)CC[C@@]3(C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C24H36O7/c1-14-7-8-18-23(30-18,13-28-15(2)25)12-20-24(31-20)17(21(4,5)27)9-10-22(24,6)19(11-14)29-16(3)26/h17-20,27H,1,7-13H2,2-6H3/t17-,18-,19+,20+,22-,23-,24-/m0/s1 |
| InChIKey | JGNUHKAFRLWUOA-PXJJFVDNSA-N |
| XLogP | 3.07 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|