C19H22O8 — CID 162940933
[(1R,2S,4R,6R,9E,11R)-2-acetyloxy-9-formyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-4-yl]methyl acetate (PubChem CID 162940933) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is [(1R,2S,4R,6R,9E,11R)-2-acetyloxy-9-formyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-4-yl]methyl acetate.
| Compound Name | [(1R,2S,4R,6R,9E,11R)-2-acetyloxy-9-formyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-4-yl]methyl acetate |
|---|---|
| PubChem CID | 162940933 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(1R,2S,4R,6R,9E,11R)-2-acetyloxy-9-formyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-4-yl]methyl acetate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C=O)CC[C@H]3O[C@@]3(COC(C)=O)C[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C19H22O8/c1-10-17-14(26-18(10)23)6-13(8-20)4-5-16-19(27-16,9-24-11(2)21)7-15(17)25-12(3)22/h6,8,14-17H,1,4-5,7,9H2,2-3H3/b13-6+/t14-,15+,16-,17+,19-/m1/s1 |
| InChIKey | FIUKBHLOUGCTHU-PAZPRULQSA-N |
| XLogP | 1.03 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|