C13H20O2 — CID 155673445
(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methyl acetate (PubChem CID 155673445) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methyl acetate.
| Compound Name | (2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methyl acetate |
|---|---|
| PubChem CID | 155673445 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methyl acetate |
| SMILES | C=C1C2CCC(COC(C)=O)(C2)C1(C)C |
| InChI | InChI=1S/C13H20O2/c1-9-11-5-6-13(7-11,12(9,3)4)8-15-10(2)14/h11H,1,5-8H2,2-4H3 |
| InChIKey | ICNLEUZUVXTUHZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|