C12H19NO — CID 15226169
N-(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 15226169) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | N-(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 15226169 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | C=C1C2CCC(NC(C)=O)(C2)C1(C)C |
| InChI | InChI=1S/C12H19NO/c1-8-10-5-6-12(7-10,11(8,3)4)13-9(2)14/h10H,1,5-7H2,2-4H3,(H,13,14) |
| InChIKey | RZYOTQJONAWEEQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|