C12H23NO — CID 146393556
N-(1-methyl-4-propan-2-ylcyclohexyl)acetamide (PubChem CID 146393556) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(1-methyl-4-propan-2-ylcyclohexyl)acetamide.
| Compound Name | N-(1-methyl-4-propan-2-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 146393556 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(1-methyl-4-propan-2-ylcyclohexyl)acetamide |
| SMILES | CC(=O)NC1(C)CCC(C(C)C)CC1 |
| InChI | InChI=1S/C12H23NO/c1-9(2)11-5-7-12(4,8-6-11)13-10(3)14/h9,11H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | FBHIZPVSEUNZNO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |