C24H42O6 — CID 150013736
(2R,3R)-2,3-dihydroxy-2,3-bis(1-methyl-4-propan-2-ylcyclohexyl)butanedioic acid (PubChem CID 150013736) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-2,3-bis(1-methyl-4-propan-2-ylcyclohexyl)butanedioic acid.
| Compound Name | (2R,3R)-2,3-dihydroxy-2,3-bis(1-methyl-4-propan-2-ylcyclohexyl)butanedioic acid |
|---|---|
| PubChem CID | 150013736 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-2,3-bis(1-methyl-4-propan-2-ylcyclohexyl)butanedioic acid |
| SMILES | CC(C)C1CCC(C)([C@](O)(C(=O)O)[C@@](O)(C(=O)O)C2(C)CCC(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H42O6/c1-15(2)17-7-11-21(5,12-8-17)23(29,19(25)26)24(30,20(27)28)22(6)13-9-18(10-14-22)16(3)4/h15-18,29-30H,7-14H2,1-6H3,(H,25,26)(H,27,28)/t17?,18?,21?,22?,23-,24-/m1/s1 |
| InChIKey | DDUZWXTUGJHHEO-NNKWOFFFSA-N |
| XLogP | 4.32 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |