C13H21F3O2S — CID 116627842
4-propan-2-yl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxylic acid (PubChem CID 116627842) has the molecular formula C13H21F3O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-propan-2-yl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-propan-2-yl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 116627842 |
| Molecular Formula | C13H21F3O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-propan-2-yl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)C1CCC(CCSC(F)(F)F)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H21F3O2S/c1-9(2)10-3-5-12(6-4-10,11(17)18)7-8-19-13(14,15)16/h9-10H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | JVTOQAZTJDUDPI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |