C15H24O2 — CID 104813004
1-pent-3-ynyl-4-propan-2-ylcyclohexane-1-carboxylic acid (PubChem CID 104813004) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-pent-3-ynyl-4-propan-2-ylcyclohexane-1-carboxylic acid.
| Compound Name | 1-pent-3-ynyl-4-propan-2-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104813004 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-pent-3-ynyl-4-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES | CC#CCCC1(C(=O)O)CCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H24O2/c1-4-5-6-9-15(14(16)17)10-7-13(8-11-15)12(2)3/h12-13H,6-11H2,1-3H3,(H,16,17) |
| InChIKey | ZQTCKEJRUWLMKO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|