C11H17ClO3 — CID 87815376
1-carbonochloridoyl-4-propan-2-ylcyclohexane-1-carboxylic acid (PubChem CID 87815376) has the molecular formula C11H17ClO3 and a molecular weight of 232.71 g/mol. Its IUPAC name is 1-carbonochloridoyl-4-propan-2-ylcyclohexane-1-carboxylic acid.
| Compound Name | 1-carbonochloridoyl-4-propan-2-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 87815376 |
| Molecular Formula | C11H17ClO3 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-carbonochloridoyl-4-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES | CC(C)C1CCC(C(=O)O)(C(=O)Cl)CC1 |
| InChI | InChI=1S/C11H17ClO3/c1-7(2)8-3-5-11(6-4-8,9(12)13)10(14)15/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | VCWVWYNROWCZIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|