C16H22O8 — CID 69129361
4-(4,4-dicarboxycyclohexyl)cyclohexane-1,1-dicarboxylic acid (PubChem CID 69129361) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 4-(4,4-dicarboxycyclohexyl)cyclohexane-1,1-dicarboxylic acid.
| Compound Name | 4-(4,4-dicarboxycyclohexyl)cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 69129361 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-(4,4-dicarboxycyclohexyl)cyclohexane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCC(C2CCC(C(=O)O)(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C16H22O8/c17-11(18)15(12(19)20)5-1-9(2-6-15)10-3-7-16(8-4-10,13(21)22)14(23)24/h9-10H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | CMVKWSAJXYEVQO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|