C11H15NS — CID 139815055
1-isothiocyanato-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane (PubChem CID 139815055) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 1-isothiocyanato-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane.
| Compound Name | 1-isothiocyanato-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 139815055 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-isothiocyanato-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1C2CCC(N=C=S)(C2)C1(C)C |
| InChI | InChI=1S/C11H15NS/c1-8-9-4-5-11(6-9,12-7-13)10(8,2)3/h9H,1,4-6H2,2-3H3 |
| InChIKey | DBLZGQCQUCLYPM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|