C14H19N3S — CID 162715201
N-[(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 162715201) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | N-[(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 162715201 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | C=C1C2CCC(C=NNc3nccs3)(C2)C1(C)C |
| InChI | InChI=1S/C14H19N3S/c1-10-11-4-5-14(8-11,13(10,2)3)9-16-17-12-15-6-7-18-12/h6-7,9,11H,1,4-5,8H2,2-3H3,(H,15,17) |
| InChIKey | DGJZVZWTFXAHGC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|