C19H24O — CID 162827825
1-[(1S,4S)-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one (PubChem CID 162827825) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[(1S,4S)-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one.
| Compound Name | 1-[(1S,4S)-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 162827825 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[(1S,4S)-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one |
| SMILES | C=C1[C@H]2CC[C@](C(=O)CCc3ccccc3)(C2)C1(C)C |
| InChI | InChI=1S/C19H24O/c1-14-16-11-12-19(13-16,18(14,2)3)17(20)10-9-15-7-5-4-6-8-15/h4-8,16H,1,9-13H2,2-3H3/t16-,19+/m0/s1 |
| InChIKey | NARPGYKBWFJVGU-QFBILLFUSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|