C24H32O3 — CID 162863780
1-[(1S,2R,4R,7R)-2-cyclopentyl-7-hydroxy-7-methoxy-2-methyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one (PubChem CID 162863780) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[(1S,2R,4R,7R)-2-cyclopentyl-7-hydroxy-7-methoxy-2-methyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one.
| Compound Name | 1-[(1S,2R,4R,7R)-2-cyclopentyl-7-hydroxy-7-methoxy-2-methyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 162863780 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-[(1S,2R,4R,7R)-2-cyclopentyl-7-hydroxy-7-methoxy-2-methyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-phenylpropan-1-one |
| SMILES | C=C1[C@H]2CC[C@@](C(=O)CCc3ccccc3)([C@]1(C)C1CCCC1)[C@]2(O)OC |
| InChI | InChI=1S/C24H32O3/c1-17-20-15-16-23(24(20,26)27-3,22(17,2)19-11-7-8-12-19)21(25)14-13-18-9-5-4-6-10-18/h4-6,9-10,19-20,26H,1,7-8,11-16H2,2-3H3/t20-,22+,23-,24-/m1/s1 |
| InChIKey | WORPDIQGBLPXBX-GNLZIIPMSA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|