C25H32O9 — CID 101022154
[2,8,8-tris(acetyloxymethyl)-5-oxo-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-2-yl]methyl acetate (PubChem CID 101022154) has the molecular formula C25H32O9 and a molecular weight of 476.52 g/mol. Its IUPAC name is [2,8,8-tris(acetyloxymethyl)-5-oxo-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-2-yl]methyl acetate.
| Compound Name | [2,8,8-tris(acetyloxymethyl)-5-oxo-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101022154 |
| Molecular Formula | C25H32O9 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [2,8,8-tris(acetyloxymethyl)-5-oxo-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1(COC(C)=O)CC2=CC(=O)CC3CC(COC(C)=O)(COC(C)=O)CC3=C2C1 |
| InChI | InChI=1S/C25H32O9/c1-15(26)31-11-24(12-32-16(2)27)7-19-5-21(30)6-20-8-25(13-33-17(3)28,14-34-18(4)29)10-23(20)22(19)9-24/h5,20H,6-14H2,1-4H3 |
| InChIKey | PIXDHDDKSSMFBA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|