C21H32O5 — CID 101022152
2,2,8,8-tetrakis(methoxymethyl)-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-5-one (PubChem CID 101022152) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2,2,8,8-tetrakis(methoxymethyl)-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-5-one.
| Compound Name | 2,2,8,8-tetrakis(methoxymethyl)-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-5-one |
|---|---|
| PubChem CID | 101022152 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2,2,8,8-tetrakis(methoxymethyl)-1,3,3a,4,7,9-hexahydrocyclopenta[e]azulen-5-one |
| SMILES | COCC1(COC)CC2=CC(=O)CC3CC(COC)(COC)CC3=C2C1 |
| InChI | InChI=1S/C21H32O5/c1-23-11-20(12-24-2)7-15-5-17(22)6-16-8-21(13-25-3,14-26-4)10-19(16)18(15)9-20/h5,16H,6-14H2,1-4H3 |
| InChIKey | XSEVHMYCGPUUDB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |