C9H16O3 — CID 146049054
3,3-bis(methoxymethyl)-6-oxabicyclo[3.1.0]hexane (PubChem CID 146049054) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 3,3-bis(methoxymethyl)-6-oxabicyclo[3.1.0]hexane.
| Compound Name | 3,3-bis(methoxymethyl)-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 146049054 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3,3-bis(methoxymethyl)-6-oxabicyclo[3.1.0]hexane |
| SMILES | COCC1(COC)CC2OC2C1 |
| InChI | InChI=1S/C9H16O3/c1-10-5-9(6-11-2)3-7-8(4-9)12-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | VQMQUHNRQLAGPG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|