C19H36O7 — CID 58835826
3,3-bis[2-(2-ethoxyethoxy)ethoxymethyl]-6-oxabicyclo[3.1.0]hexane (PubChem CID 58835826) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is 3,3-bis[2-(2-ethoxyethoxy)ethoxymethyl]-6-oxabicyclo[3.1.0]hexane.
| Compound Name | 3,3-bis[2-(2-ethoxyethoxy)ethoxymethyl]-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 58835826 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3,3-bis[2-(2-ethoxyethoxy)ethoxymethyl]-6-oxabicyclo[3.1.0]hexane |
| SMILES | CCOCCOCCOCC1(COCCOCCOCC)CC2OC2C1 |
| InChI | InChI=1S/C19H36O7/c1-3-20-5-7-22-9-11-24-15-19(13-17-18(14-19)26-17)16-25-12-10-23-8-6-21-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | WWKSYPKRPWIROA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|