C25H38O5 — CID 4212984
(14-acetyloxy-7,11,16-trimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-6-yl)methyl acetate (PubChem CID 4212984) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (14-acetyloxy-7,11,16-trimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-6-yl)methyl acetate.
| Compound Name | (14-acetyloxy-7,11,16-trimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-6-yl)methyl acetate |
|---|---|
| PubChem CID | 4212984 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (14-acetyloxy-7,11,16-trimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1CC2OC23C2CCC4(C)CC(OC(C)=O)CCC4(C)C2CCC13C |
| InChI | InChI=1S/C25H38O5/c1-15(26)28-14-17-12-21-25(30-21)20-7-9-22(3)13-18(29-16(2)27)6-10-24(22,5)19(20)8-11-23(17,25)4/h17-21H,6-14H2,1-5H3 |
| InChIKey | ULGAXLBHRPIQOX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|