C25H36O8 — CID 4678001
methyl 5,14-diacetyloxy-16-hydroxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate (PubChem CID 4678001) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is methyl 5,14-diacetyloxy-16-hydroxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate.
| Compound Name | methyl 5,14-diacetyloxy-16-hydroxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate |
|---|---|
| PubChem CID | 4678001 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | methyl 5,14-diacetyloxy-16-hydroxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate |
| SMILES | COC(=O)C1C(OC(C)=O)C2OC23C2CCC4(O)CC(OC(C)=O)CCC4(C)C2CCC13C |
| InChI | InChI=1S/C25H36O8/c1-13(26)31-15-6-9-22(3)16-7-10-23(4)18(21(28)30-5)19(32-14(2)27)20-25(23,33-20)17(16)8-11-24(22,29)12-15/h15-20,29H,6-12H2,1-5H3 |
| InChIKey | KVLXHBCFRJQGBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|