C30H42N2O6 — CID 118872969
[(1R,2S,4R,5R,6R,7R,10S,11R,14S,16S)-16-hydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-14-piperazin-1-yl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate (PubChem CID 118872969) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is [(1R,2S,4R,5R,6R,7R,10S,11R,14S,16S)-16-hydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-14-piperazin-1-yl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate.
| Compound Name | [(1R,2S,4R,5R,6R,7R,10S,11R,14S,16S)-16-hydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-14-piperazin-1-yl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 118872969 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | [(1R,2S,4R,5R,6R,7R,10S,11R,14S,16S)-16-hydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-14-piperazin-1-yl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@]23[C@@H]2CC[C@]4(O)C[C@@H](N5CCNCC5)CC[C@]4(C)[C@H]2CC[C@]3(C)[C@H]1c1ccc(=O)oc1 |
| InChI | InChI=1S/C30H42N2O6/c1-18(33)37-25-24(19-4-5-23(34)36-17-19)28(3)10-7-21-22(30(28)26(25)38-30)8-11-29(35)16-20(6-9-27(21,29)2)32-14-12-31-13-15-32/h4-5,17,20-22,24-26,31,35H,6-16H2,1-3H3/t20-,21-,22+,24-,25+,26+,27+,28+,29-,30+/m0/s1 |
| InChIKey | JOUTYKBNDMERIM-USCGJVGVSA-N |
| XLogP | 2.83 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|