C31H40O9 — CID 163037743
4-O-[(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-5-acetyloxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] 1-O-methyl butanedioate (PubChem CID 163037743) has the molecular formula C31H40O9 and a molecular weight of 556.65 g/mol. Its IUPAC name is 4-O-[(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-5-acetyloxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-5-acetyloxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 163037743 |
| Molecular Formula | C31H40O9 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 4-O-[(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-5-acetyloxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-14-yl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](c4ccc(=O)oc4)[C@@H](OC(C)=O)[C@H]4O[C@]342)C1 |
| InChI | InChI=1S/C31H40O9/c1-17(32)38-27-26(18-5-8-24(34)37-16-18)30(3)14-12-21-22(31(30)28(27)40-31)7-6-19-15-20(11-13-29(19,21)2)39-25(35)10-9-23(33)36-4/h5,8,16,19-22,26-28H,6-7,9-15H2,1-4H3/t19-,20+,21+,22-,26+,27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | HLNMELUUOTWQDF-BRJVRDAOSA-N |
| XLogP | 4.30 |
| TPSA | 121.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|