C32H44O11 — CID 73231615
[7,11-dimethyl-6-(6-oxopyran-3-yl)-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate (PubChem CID 73231615) has the molecular formula C32H44O11 and a molecular weight of 604.69 g/mol. Its IUPAC name is [7,11-dimethyl-6-(6-oxopyran-3-yl)-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate.
| Compound Name | [7,11-dimethyl-6-(6-oxopyran-3-yl)-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 73231615 |
| Molecular Formula | C32H44O11 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | [7,11-dimethyl-6-(6-oxopyran-3-yl)-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)OC1C(c2ccc(=O)oc2)C2(C)CCC3C(CCC4CC(OC5OC(CO)C(O)C(O)C5O)CCC43C)C23OC13 |
| InChI | InChI=1S/C32H44O11/c1-15(34)40-27-23(16-4-7-22(35)39-14-16)31(3)11-9-19-20(32(31)28(27)43-32)6-5-17-12-18(8-10-30(17,19)2)41-29-26(38)25(37)24(36)21(13-33)42-29/h4,7,14,17-21,23-29,33,36-38H,5-6,8-13H2,1-3H3 |
| InChIKey | LTFQQGPJNXCYAC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|