C31H41N3O7 — CID 121327202
[(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-14-[(3-oxopiperazine-1-carbonyl)amino]-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate (PubChem CID 121327202) has the molecular formula C31H41N3O7 and a molecular weight of 567.68 g/mol. Its IUPAC name is [(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-14-[(3-oxopiperazine-1-carbonyl)amino]-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate.
| Compound Name | [(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-14-[(3-oxopiperazine-1-carbonyl)amino]-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 121327202 |
| Molecular Formula | C31H41N3O7 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | [(1R,2S,4R,5R,6R,7R,10S,11S,14S,16R)-7,11-dimethyl-14-[(3-oxopiperazine-1-carbonyl)amino]-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@]23[C@@H]2CC[C@@H]4C[C@@H](NC(=O)N5CCNC(=O)C5)CC[C@]4(C)[C@H]2CC[C@]3(C)[C@H]1c1ccc(=O)oc1 |
| InChI | InChI=1S/C31H41N3O7/c1-17(35)40-26-25(18-4-7-24(37)39-16-18)30(3)11-9-21-22(31(30)27(26)41-31)6-5-19-14-20(8-10-29(19,21)2)33-28(38)34-13-12-32-23(36)15-34/h4,7,16,19-22,25-27H,5-6,8-15H2,1-3H3,(H,32,36)(H,33,38)/t19-,20+,21+,22-,25+,26-,27-,29+,30-,31-/m1/s1 |
| InChIKey | MWAPTCVMKSCECW-NXVAQELGSA-N |
| XLogP | 2.95 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|