C26H34O7 — CID 73300644
[9,14-dihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate (PubChem CID 73300644) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is [9,14-dihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate.
| Compound Name | [9,14-dihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 73300644 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [9,14-dihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)OC1C(c2ccc(=O)oc2)C2(C)CC(O)C3C(CCC4CC(O)CCC43C)C23OC13 |
| InChI | InChI=1S/C26H34O7/c1-13(27)32-22-20(14-4-7-19(30)31-12-14)25(3)11-18(29)21-17(26(25)23(22)33-26)6-5-15-10-16(28)8-9-24(15,21)2/h4,7,12,15-18,20-23,28-29H,5-6,8-11H2,1-3H3 |
| InChIKey | KEPALNVGBPKRJF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|