C26H34O8 — CID 11408879
[(1R,2S,4R,5R,6R,7S,8R,10S,11S,12R,14R,16S)-8,12,14-trihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate (PubChem CID 11408879) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(1R,2S,4R,5R,6R,7S,8R,10S,11S,12R,14R,16S)-8,12,14-trihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate.
| Compound Name | [(1R,2S,4R,5R,6R,7S,8R,10S,11S,12R,14R,16S)-8,12,14-trihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 11408879 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R,2S,4R,5R,6R,7S,8R,10S,11S,12R,14R,16S)-8,12,14-trihydroxy-7,11-dimethyl-6-(6-oxopyran-3-yl)-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@]23[C@@H]2CC[C@H]4C[C@@H](O)C[C@@H](O)[C@]4(C)[C@H]2C[C@@H](O)[C@]3(C)[C@H]1c1ccc(=O)oc1 |
| InChI | InChI=1S/C26H34O8/c1-12(27)33-22-21(13-4-7-20(31)32-11-13)25(3)19(30)10-17-16(26(25)23(22)34-26)6-5-14-8-15(28)9-18(29)24(14,17)2/h4,7,11,14-19,21-23,28-30H,5-6,8-10H2,1-3H3/t14-,15+,16+,17-,18+,19+,21-,22+,23+,24-,25+,26+/m0/s1 |
| InChIKey | APVDXKFPJURNRU-RCWUBJPASA-N |
| XLogP | 1.74 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|