C25H36O7 — CID 10297542
methyl (2S,4R,5R,6R,7R,11S,14S)-5,14-diacetyloxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate (PubChem CID 10297542) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is methyl (2S,4R,5R,6R,7R,11S,14S)-5,14-diacetyloxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate.
| Compound Name | methyl (2S,4R,5R,6R,7R,11S,14S)-5,14-diacetyloxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate |
|---|---|
| PubChem CID | 10297542 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | methyl (2S,4R,5R,6R,7R,11S,14S)-5,14-diacetyloxy-7,11-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecane-6-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OC(C)=O)[C@H]2O[C@]23C2CCC4C[C@@H](OC(C)=O)CC[C@]4(C)C2CC[C@]13C |
| InChI | InChI=1S/C25H36O7/c1-13(26)30-16-8-10-23(3)15(12-16)6-7-18-17(23)9-11-24(4)19(22(28)29-5)20(31-14(2)27)21-25(18,24)32-21/h15-21H,6-12H2,1-5H3/t15?,16-,17?,18?,19+,20+,21+,23-,24+,25+/m0/s1 |
| InChIKey | YCJJLECEFGRRFZ-GAOQCAMGSA-N |
| XLogP | 3.42 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|