C24H36O4 — CID 3338600
(15-acetyl-2,14,16-trimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl) acetate (PubChem CID 3338600) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (15-acetyl-2,14,16-trimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl) acetate.
| Compound Name | (15-acetyl-2,14,16-trimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl) acetate |
|---|---|
| PubChem CID | 3338600 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (15-acetyl-2,14,16-trimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4(C)C(CC(C)C4C(C)=O)C3CC3OC32C1 |
| InChI | InChI=1S/C24H36O4/c1-13-10-19-17-11-20-24(28-20)12-16(27-15(3)26)6-9-23(24,5)18(17)7-8-22(19,4)21(13)14(2)25/h13,16-21H,6-12H2,1-5H3 |
| InChIKey | SSZMJUMRQTUOCS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|