C24H36Cl2O3 — CID 51690104
[(3R,5R,6S,8S,9R,10R,13S,14S,16S,17R)-17-acetyl-5,6-dichloro-10,13,16-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 51690104) has the molecular formula C24H36Cl2O3 and a molecular weight of 443.46 g/mol. Its IUPAC name is [(3R,5R,6S,8S,9R,10R,13S,14S,16S,17R)-17-acetyl-5,6-dichloro-10,13,16-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5R,6S,8S,9R,10R,13S,14S,16S,17R)-17-acetyl-5,6-dichloro-10,13,16-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 51690104 |
| Molecular Formula | C24H36Cl2O3 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [(3R,5R,6S,8S,9R,10R,13S,14S,16S,17R)-17-acetyl-5,6-dichloro-10,13,16-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@@H]3CC[C@]4(C)[C@H](C(C)=O)[C@@H](C)C[C@H]4[C@@H]3C[C@H](Cl)[C@@]2(Cl)C1 |
| InChI | InChI=1S/C24H36Cl2O3/c1-13-10-19-17-11-20(25)24(26)12-16(29-15(3)28)6-9-23(24,5)18(17)7-8-22(19,4)21(13)14(2)27/h13,16-21H,6-12H2,1-5H3/t13-,16+,17+,18+,19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | PYBGGSNABBXWHO-FMYFCUQHSA-N |
| XLogP | 5.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|