C23H34Cl2O3 — CID 70569121
[(3S,5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-5,6-dichloro-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 70569121) has the molecular formula C23H34Cl2O3 and a molecular weight of 429.43 g/mol. Its IUPAC name is [(3S,5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-5,6-dichloro-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-5,6-dichloro-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 70569121 |
| Molecular Formula | C23H34Cl2O3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [(3S,5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-5,6-dichloro-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(C)=O)CC[C@H]4[C@@H]3C[C@@H](Cl)[C@@]2(Cl)C1 |
| InChI | InChI=1S/C23H34Cl2O3/c1-13(26)17-5-6-18-16-11-20(24)23(25)12-15(28-14(2)27)7-10-22(23,4)19(16)8-9-21(17,18)3/h15-20H,5-12H2,1-4H3/t15-,16-,17+,18-,19-,20+,21+,22+,23-/m0/s1 |
| InChIKey | MCHDCPCXPLWLEJ-PWFQONRBSA-N |
| XLogP | 5.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|