C21H32Cl2O2 — CID 154141570
1-[(3S,8S,9S,10R,13S,14S,17S)-5,6-dichloro-3-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 154141570) has the molecular formula C21H32Cl2O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13S,14S,17S)-5,6-dichloro-3-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-5,6-dichloro-3-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 154141570 |
| Molecular Formula | C21H32Cl2O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-5,6-dichloro-3-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC(Cl)C4(Cl)C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32Cl2O2/c1-12(24)15-4-5-16-14-10-18(22)21(23)11-13(25)6-9-20(21,3)17(14)7-8-19(15,16)2/h13-18,25H,4-11H2,1-3H3/t13-,14-,15+,16-,17-,18?,19+,20+,21?/m0/s1 |
| InChIKey | JGCNKASGPZNQNV-XZHVOUGPSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|