C14H24O2 — CID 90364766
2-methylbutan-2-yl 1-methyl-4-methylidenecyclohexane-1-carboxylate (PubChem CID 90364766) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-methylbutan-2-yl 1-methyl-4-methylidenecyclohexane-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 1-methyl-4-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90364766 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-methylbutan-2-yl 1-methyl-4-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCC(C)(C(=O)OC(C)(C)CC)CC1 |
| InChI | InChI=1S/C14H24O2/c1-6-13(3,4)16-12(15)14(5)9-7-11(2)8-10-14/h2,6-10H2,1,3-5H3 |
| InChIKey | FKSPOPHPHFYMET-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|