C27H40O8 — CID 162844614
[8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-1-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl 2-methylbut-2-enoate (PubChem CID 162844614) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is [8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-1-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl 2-methylbut-2-enoate.
| Compound Name | [8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-1-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162844614 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-1-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC12C(OC(C)=O)CC(C)C(C)(C3CC4CCOC4O3)C1C(O)CCC21CO1 |
| InChI | InChI=1S/C27H40O8/c1-6-15(2)23(30)32-14-27-21(34-17(4)28)11-16(3)25(5,20-12-18-8-10-31-24(18)35-20)22(27)19(29)7-9-26(27)13-33-26/h6,16,18-22,24,29H,7-14H2,1-5H3 |
| InChIKey | BYLZDSBPRYUCTF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|