C28H42O10 — CID 162890163
[3,5-diacetyloxy-8-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate (PubChem CID 162890163) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is [3,5-diacetyloxy-8-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-8-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 162890163 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [3,5-diacetyloxy-8-(5-ethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-2-yl)-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
| SMILES | CCOC1CC2CC(C3(C)C(C)CC(OC(C)=O)C4(COC(C)=O)C3CCC(OC(C)=O)C43CO3)OC2O1 |
| InChI | InChI=1S/C28H42O10/c1-7-32-24-12-19-11-22(37-25(19)38-24)26(6)15(2)10-23(36-18(5)31)27(13-33-16(3)29)20(26)8-9-21(35-17(4)30)28(27)14-34-28/h15,19-25H,7-14H2,1-6H3 |
| InChIKey | KELWGSSLXXIRKR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 119.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|